C25H33F3O4 — CID 11166940
[(1S,2R,4S)-7-[(Z)-5-hydroxy-4-methylpent-3-enyl]-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11166940) has the molecular formula C25H33F3O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is [(1S,2R,4S)-7-[(Z)-5-hydroxy-4-methylpent-3-enyl]-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2R,4S)-7-[(Z)-5-hydroxy-4-methylpent-3-enyl]-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11166940 |
| Molecular Formula | C25H33F3O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | [(1S,2R,4S)-7-[(Z)-5-hydroxy-4-methylpent-3-enyl]-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)CC/C=C(/C)CO)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H33F3O4/c1-17(16-29)9-8-13-22(2)19-12-14-23(22,3)20(15-19)32-21(30)24(31-4,25(26,27)28)18-10-6-5-7-11-18/h5-7,9-11,19-20,29H,8,12-16H2,1-4H3/b17-9-/t19-,20+,22?,23+,24-/m0/s1 |
| InChIKey | HHUPHNUGONMOGQ-OHHKBXKDSA-N |
| XLogP | 5.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|