C22H27BrN4O — CID 111669850
3-[2-[[N-[2-(4-bromophenyl)cyclopropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111669850) has the molecular formula C22H27BrN4O and a molecular weight of 443.39 g/mol. Its IUPAC name is 3-[2-[[N-[2-(4-bromophenyl)cyclopropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N-[2-(4-bromophenyl)cyclopropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111669850 |
| Molecular Formula | C22H27BrN4O |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[2-[[N-[2-(4-bromophenyl)cyclopropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)N(C)C)c1)NC1CC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H27BrN4O/c1-24-22(26-20-14-19(20)16-7-9-18(23)10-8-16)25-12-11-15-5-4-6-17(13-15)21(28)27(2)3/h4-10,13,19-20H,11-12,14H2,1-3H3,(H2,24,25,26) |
| InChIKey | RRJDOTMMDUBKFK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|