C23H25BrN2O3 — CID 11167008
(1S)-2-[(4S,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4,5-diphenyl-1,3-oxazol-2-yl)ethanamine (PubChem CID 11167008) has the molecular formula C23H25BrN2O3 and a molecular weight of 457.37 g/mol. Its IUPAC name is (1S)-2-[(4S,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4,5-diphenyl-1,3-oxazol-2-yl)ethanamine.
| Compound Name | (1S)-2-[(4S,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4,5-diphenyl-1,3-oxazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 11167008 |
| Molecular Formula | C23H25BrN2O3 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (1S)-2-[(4S,5R)-5-(bromomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4,5-diphenyl-1,3-oxazol-2-yl)ethanamine |
| SMILES | CC1(C)O[C@@H](CBr)[C@H](C[C@H](N)c2nc(-c3ccccc3)c(-c3ccccc3)o2)O1 |
| InChI | InChI=1S/C23H25BrN2O3/c1-23(2)28-18(19(14-24)29-23)13-17(25)22-26-20(15-9-5-3-6-10-15)21(27-22)16-11-7-4-8-12-16/h3-12,17-19H,13-14,25H2,1-2H3/t17-,18-,19-/m0/s1 |
| InChIKey | DGWQJEVPNVAEKH-FHWLQOOXSA-N |
| XLogP | 5.31 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|