C17H21F2N3O2S — CID 111671216
1-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 111671216) has the molecular formula C17H21F2N3O2S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111671216 |
| Molecular Formula | C17H21F2N3O2S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccsc1)NCc1ccc(OC)cc1OC(F)F |
| InChI | InChI=1S/C17H21F2N3O2S/c1-3-20-17(21-9-12-6-7-25-11-12)22-10-13-4-5-14(23-2)8-15(13)24-16(18)19/h4-8,11,16H,3,9-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | RXVRFGJVINSIFB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|