C27H44O6 — CID 11167185
(9E)-4,8-dihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one (PubChem CID 11167185) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is (9E)-4,8-dihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-4,8-dihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 11167185 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (9E)-4,8-dihydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(O)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCCC(O)/C=C/C1C |
| InChI | InChI=1S/C27H44O6/c1-6-23(30)20(5)27-24(32-27)15-17(2)9-7-10-18(3)26-19(4)13-14-21(28)11-8-12-22(29)16-25(31)33-26/h7,9-10,13-14,17,19-24,26-30H,6,8,11-12,15-16H2,1-5H3/b9-7+,14-13+,18-10+ |
| InChIKey | ACULRNJHOWOWRS-SYJVYHDXSA-N |
| XLogP | 4.09 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|