C20H18F3N5OS2 — CID 11167200
3-cyano-1-methyl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]guanidine (PubChem CID 11167200) has the molecular formula C20H18F3N5OS2 and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-cyano-1-methyl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]guanidine.
| Compound Name | 3-cyano-1-methyl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 11167200 |
| Molecular Formula | C20H18F3N5OS2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 3-cyano-1-methyl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]guanidine |
| SMILES | CN(/C(=N/c1ccc(OCCCC(F)(F)F)cc1)NC#N)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C20H18F3N5OS2/c1-28(14-5-8-16-17(11-14)31-19(30)27-16)18(25-12-24)26-13-3-6-15(7-4-13)29-10-2-9-20(21,22)23/h3-8,11H,2,9-10H2,1H3,(H,25,26)(H,27,30) |
| InChIKey | CVCRJAWGQMBFKB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|