C15H16BrN3O2 — CID 1116724
2-(4-bromophenyl)-5-methyl-4-(morpholin-4-ylmethylidene)pyrazol-3-one (PubChem CID 1116724) has the molecular formula C15H16BrN3O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-methyl-4-(morpholin-4-ylmethylidene)pyrazol-3-one.
| Compound Name | 2-(4-bromophenyl)-5-methyl-4-(morpholin-4-ylmethylidene)pyrazol-3-one |
|---|---|
| PubChem CID | 1116724 |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-(4-bromophenyl)-5-methyl-4-(morpholin-4-ylmethylidene)pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(Br)cc2)C(=O)C1=CN1CCOCC1 |
| InChI | InChI=1S/C15H16BrN3O2/c1-11-14(10-18-6-8-21-9-7-18)15(20)19(17-11)13-4-2-12(16)3-5-13/h2-5,10H,6-9H2,1H3 |
| InChIKey | SDRZPCNYSHMWGK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|