C28H35ClN2O2 — CID 11167242
2-[2-(4-chlorophenyl)-1H-indol-3-yl]-N,N-dihexyl-2-oxoacetamide (PubChem CID 11167242) has the molecular formula C28H35ClN2O2 and a molecular weight of 467.05 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1H-indol-3-yl]-N,N-dihexyl-2-oxoacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-1H-indol-3-yl]-N,N-dihexyl-2-oxoacetamide |
|---|---|
| PubChem CID | 11167242 |
| Molecular Formula | C28H35ClN2O2 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1H-indol-3-yl]-N,N-dihexyl-2-oxoacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(=O)c1c(-c2ccc(Cl)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C28H35ClN2O2/c1-3-5-7-11-19-31(20-12-8-6-4-2)28(33)27(32)25-23-13-9-10-14-24(23)30-26(25)21-15-17-22(29)18-16-21/h9-10,13-18,30H,3-8,11-12,19-20H2,1-2H3 |
| InChIKey | RGUOOELDJCFEAS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|