C16H25N5O3 — CID 111672550
1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111672550) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111672550 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCc1nc(C)no1 |
| InChI | InChI=1S/C16H25N5O3/c1-4-17-15(18-9-5-8-14-20-12(2)21-24-14)19-11-16(3,22)13-7-6-10-23-13/h6-7,10,22H,4-5,8-9,11H2,1-3H3,(H2,17,18,19) |
| InChIKey | SALYMDGVFCARFH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|