C22H32IN3O3 — CID 111672867
2-[(2-cyclopentyloxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111672867) has the molecular formula C22H32IN3O3 and a molecular weight of 513.42 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672867 |
| Molecular Formula | C22H32IN3O3 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-[(2-cyclopentyloxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC1CCCC1)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C22H31N3O3.HI/c1-3-23-21(25-16-22(2,26)20-13-8-14-27-20)24-15-17-9-4-7-12-19(17)28-18-10-5-6-11-18;/h4,7-9,12-14,18,26H,3,5-6,10-11,15-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | XHJBSUBHQFIXGM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|