C26H28F2N2O2S — CID 11167313
7-[4-[(2,4-difluorophenyl)methyl]phenyl]sulfonyl-N,N,3-trimethyl-1,2,4,5-tetrahydro-3-benzazepin-8-amine (PubChem CID 11167313) has the molecular formula C26H28F2N2O2S and a molecular weight of 470.59 g/mol. Its IUPAC name is 7-[4-[(2,4-difluorophenyl)methyl]phenyl]sulfonyl-N,N,3-trimethyl-1,2,4,5-tetrahydro-3-benzazepin-8-amine.
| Compound Name | 7-[4-[(2,4-difluorophenyl)methyl]phenyl]sulfonyl-N,N,3-trimethyl-1,2,4,5-tetrahydro-3-benzazepin-8-amine |
|---|---|
| PubChem CID | 11167313 |
| Molecular Formula | C26H28F2N2O2S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 7-[4-[(2,4-difluorophenyl)methyl]phenyl]sulfonyl-N,N,3-trimethyl-1,2,4,5-tetrahydro-3-benzazepin-8-amine |
| SMILES | CN1CCc2cc(N(C)C)c(S(=O)(=O)c3ccc(Cc4ccc(F)cc4F)cc3)cc2CC1 |
| InChI | InChI=1S/C26H28F2N2O2S/c1-29(2)25-15-19-10-12-30(3)13-11-20(19)16-26(25)33(31,32)23-8-4-18(5-9-23)14-21-6-7-22(27)17-24(21)28/h4-9,15-17H,10-14H2,1-3H3 |
| InChIKey | PLEZUSBUNPMWHW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |