C19H28IN3OS — CID 111673791
1-[[4-(methoxymethyl)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111673791) has the molecular formula C19H28IN3OS and a molecular weight of 473.42 g/mol. Its IUPAC name is 1-[[4-(methoxymethyl)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(methoxymethyl)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673791 |
| Molecular Formula | C19H28IN3OS |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[[4-(methoxymethyl)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(COC)cc1)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C19H27N3OS.HI/c1-15(11-18-5-4-10-24-18)12-21-19(20-2)22-13-16-6-8-17(9-7-16)14-23-3;/h4-10,15H,11-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | SUYYDWIYNFOICV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|