About 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea
1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea (PubChem CID 11167612) has the molecular formula C27H25N5O4
and a molecular weight of 483.53 g/mol. Its IUPAC name is 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea.
Molecular Properties
| Compound Name | 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea |
| PubChem CID | 11167612 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea |
| SMILES | COc1cc2nccc(Oc3ccc4c(NC(=O)Nc5ccc(C)cc5)nn(C)c4c3)c2cc1OC |
| InChI | InChI=1S/C27H25N5O4/c1-16-5-7-17(8-6-16)29-27(33)30-26-19-10-9-18(13-22(19)32(2)31-26)36-23-11-12-28-21-15-25(35-4)24(34-3)14-20(21)23/h5-15H,1-4H3,(H2,29,30,31,33) |
| InChIKey | ILJAQTWNHCZSRL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea?
The IUPAC name of 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea (CID 11167612) is 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea.
What is the SMILES notation for 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea?
The canonical SMILES for 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea is COc1cc2nccc(Oc3ccc4c(NC(=O)Nc5ccc(C)cc5)nn(C)c4c3)c2cc1OC.
What is the InChIKey of 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea?
The InChIKey is ILJAQTWNHCZSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N5O4/c1-16-5-7-17(8-6-16)29-27(33)30-26-19-10-9-18(13-22(19)32(2)31-26)36-23-11-12-28-21-15-25(35-4)24(34-3)14-20(21)23/h5-15H,1-4H3,(H2,29,30,31,33).
What are the key properties of 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea?
1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea has a molecular weight of 483.53 g/mol, XLogP of 5.88, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-yl]-3-(4-methylphenyl)urea is sourced from PubChem (CID 11167612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).