C17H29N7O — CID 111676532
1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111676532) has the molecular formula C17H29N7O and a molecular weight of 347.47 g/mol. Its IUPAC name is 1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111676532 |
| Molecular Formula | C17H29N7O |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1CC)NCc1cc(C(CC)CC)no1 |
| InChI | InChI=1S/C17H29N7O/c1-5-13(6-2)15-9-14(25-23-15)10-19-17(18-7-3)20-11-16-22-21-12-24(16)8-4/h9,12-13H,5-8,10-11H2,1-4H3,(H2,18,19,20) |
| InChIKey | AUYSMXMIQCMDEB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|