C28H26N2O6 — CID 11167667
dimethyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate (PubChem CID 11167667) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is dimethyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate.
| Compound Name | dimethyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11167667 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | dimethyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(c3ccccc3)CN(c3ccc(OC)cc3)[C@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C28H26N2O6/c1-33-22-16-14-21(15-17-22)29-18-28(20-12-8-5-9-13-20)23(26(31)34-2)24(27(32)35-3)36-30(28)25(29)19-10-6-4-7-11-19/h4-17,25H,18H2,1-3H3/t25-,28-/m0/s1 |
| InChIKey | XAXCLNYEPJUVAW-LSYYVWMOSA-N |
| XLogP | 3.96 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|