C21H25FN6O — CID 111677770
1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111677770) has the molecular formula C21H25FN6O and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111677770 |
| Molecular Formula | C21H25FN6O |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2C)nc1)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN6O/c1-15(29-19-7-5-18(22)6-8-19)12-26-21(23-3)27-14-17-4-9-20(25-13-17)28-11-10-24-16(28)2/h4-11,13,15H,12,14H2,1-3H3,(H2,23,26,27) |
| InChIKey | BAIJHXLYKZCMQZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|