C17H24FIN4OS — CID 111678789
1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111678789) has the molecular formula C17H24FIN4OS and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111678789 |
| Molecular Formula | C17H24FIN4OS |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCC(C)Oc1ccc(F)cc1.I |
| InChI | InChI=1S/C17H23FN4OS.HI/c1-12(23-16-6-4-14(18)5-7-16)10-21-17(19-3)20-9-8-15-11-24-13(2)22-15;/h4-7,11-12H,8-10H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | IVWDHDBOYBTIKO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|