C30H40O6 — CID 11167883
(1R,3Z,7S,8S,16S,18R)-16-methyl-8-[(E)-2-(4-methyl-3,6-dihydro-2H-pyran-2-yl)ethenyl]-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione (PubChem CID 11167883) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is (1R,3Z,7S,8S,16S,18R)-16-methyl-8-[(E)-2-(4-methyl-3,6-dihydro-2H-pyran-2-yl)ethenyl]-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione.
| Compound Name | (1R,3Z,7S,8S,16S,18R)-16-methyl-8-[(E)-2-(4-methyl-3,6-dihydro-2H-pyran-2-yl)ethenyl]-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione |
|---|---|
| PubChem CID | 11167883 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (1R,3Z,7S,8S,16S,18R)-16-methyl-8-[(E)-2-(4-methyl-3,6-dihydro-2H-pyran-2-yl)ethenyl]-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione |
| SMILES | C=C1CC(=O)CC2C[C@H](OC(=O)/C=C\C[C@@H]3C=CC[C@@H](C[C@@H](C)C1)O3)[C@H](/C=C/C1CC(C)=CCO1)O2 |
| InChI | InChI=1S/C30H40O6/c1-20-12-13-33-25(16-20)10-11-28-29-19-27(35-28)18-23(31)15-21(2)14-22(3)17-26-8-4-6-24(34-26)7-5-9-30(32)36-29/h4-6,9-12,22,24-29H,2,7-8,13-19H2,1,3H3/b9-5-,11-10+/t22-,24-,25?,26-,27?,28-,29-/m0/s1 |
| InChIKey | DTELCWQVSHCQEY-IRHZOTJVSA-N |
| XLogP | 5.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|