C17H25N5O2 — CID 111679038
1-ethyl-3-[2-(3-methoxyphenoxy)propyl]-2-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111679038) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methoxyphenoxy)propyl]-2-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methoxyphenoxy)propyl]-2-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111679038 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-methoxyphenoxy)propyl]-2-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCC(C)Oc1cccc(OC)c1 |
| InChI | InChI=1S/C17H25N5O2/c1-4-18-17(20-12-14-8-9-21-22-14)19-11-13(2)24-16-7-5-6-15(10-16)23-3/h5-10,13H,4,11-12H2,1-3H3,(H,21,22)(H2,18,19,20) |
| InChIKey | QDJATFFNOLSBSM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|