C20H36IN3O4 — CID 111679403
1-ethyl-3-[4-(2-methoxyethoxy)butyl]-2-[2-(3-methoxyphenoxy)propyl]guanidine;hydroiodide (PubChem CID 111679403) has the molecular formula C20H36IN3O4 and a molecular weight of 509.43 g/mol. Its IUPAC name is 1-ethyl-3-[4-(2-methoxyethoxy)butyl]-2-[2-(3-methoxyphenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-(2-methoxyethoxy)butyl]-2-[2-(3-methoxyphenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111679403 |
| Molecular Formula | C20H36IN3O4 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 1-ethyl-3-[4-(2-methoxyethoxy)butyl]-2-[2-(3-methoxyphenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Oc1cccc(OC)c1)NCCCCOCCOC.I |
| InChI | InChI=1S/C20H35N3O4.HI/c1-5-21-20(22-11-6-7-12-26-14-13-24-3)23-16-17(2)27-19-10-8-9-18(15-19)25-4;/h8-10,15,17H,5-7,11-14,16H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | DAAVJLLZPKNWCN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|