C24H17Cl2F3N2O3 — CID 11168141
3-[[5,7-dichloro-2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid (PubChem CID 11168141) has the molecular formula C24H17Cl2F3N2O3 and a molecular weight of 509.31 g/mol. Its IUPAC name is 3-[[5,7-dichloro-2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid.
| Compound Name | 3-[[5,7-dichloro-2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 11168141 |
| Molecular Formula | C24H17Cl2F3N2O3 |
| Molecular Weight | 509.31 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 3-[[5,7-dichloro-2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1c(Cl)cc2nc(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)oc2c1Cl |
| InChI | InChI=1S/C24H17Cl2F3N2O3/c25-18-11-19-22(21(26)16(18)12-30-9-8-20(32)33)34-23(31-19)14-6-7-15(13-4-2-1-3-5-13)17(10-14)24(27,28)29/h1-7,10-11,30H,8-9,12H2,(H,32,33) |
| InChIKey | KDMFTTWCXIJYCN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.31 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|