C21H26FN3O3 — CID 111681804
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine (PubChem CID 111681804) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111681804 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[2-(3-fluorophenoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCCCO2)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C21H26FN3O3/c1-15(28-18-6-3-5-17(22)12-18)13-24-21(23-2)25-14-16-7-8-19-20(11-16)27-10-4-9-26-19/h3,5-8,11-12,15H,4,9-10,13-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | FSESRTCBMNYKMH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|