C20H28FIN4O2 — CID 111681813
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide (PubChem CID 111681813) has the molecular formula C20H28FIN4O2 and a molecular weight of 502.37 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111681813 |
| Molecular Formula | C20H28FIN4O2 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCn1ccccc1=O)NCC(C)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C20H27FN4O2.HI/c1-16(27-18-9-7-8-17(21)14-18)15-24-20(22-2)23-11-4-6-13-25-12-5-3-10-19(25)26;/h3,5,7-10,12,14,16H,4,6,11,13,15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | AFTPGPSZSBKRDX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|