C25H34F4N4O3 — CID 11168235
3-(cyclobutylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione (PubChem CID 11168235) has the molecular formula C25H34F4N4O3 and a molecular weight of 514.56 g/mol. Its IUPAC name is 3-(cyclobutylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(cyclobutylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11168235 |
| Molecular Formula | C25H34F4N4O3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-(cyclobutylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CCCN2CCN(c3ccccc3OCC(F)(F)C(F)F)CC2)C(=O)C1NC1CCC1 |
| InChI | InChI=1S/C25H34F4N4O3/c1-17-21(30-18-6-4-7-18)23(35)33(22(17)34)11-5-10-31-12-14-32(15-13-31)19-8-2-3-9-20(19)36-16-25(28,29)24(26)27/h2-3,8-9,17-18,21,24,30H,4-7,10-16H2,1H3 |
| InChIKey | WIDYUJXXDVXZEN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|