C24H34N4O3 — CID 111682702
N-[4-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 111682702) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111682702 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N-[4-[[[ethylamino-[2-(2-methoxyphenoxy)propylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)C(C)C)cc1)NCC(C)Oc1ccccc1OC |
| InChI | InChI=1S/C24H34N4O3/c1-6-25-24(26-15-18(4)31-22-10-8-7-9-21(22)30-5)27-16-19-11-13-20(14-12-19)28-23(29)17(2)3/h7-14,17-18H,6,15-16H2,1-5H3,(H,28,29)(H2,25,26,27) |
| InChIKey | PAVJESXDLJAQCQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|