C24H28ClN5O4S — CID 11168308
(2R)-1-N-(4-chlorophenyl)-2-N-[4-[(E)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]phenyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 11168308) has the molecular formula C24H28ClN5O4S and a molecular weight of 518.04 g/mol. Its IUPAC name is (2R)-1-N-(4-chlorophenyl)-2-N-[4-[(E)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]phenyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(4-chlorophenyl)-2-N-[4-[(E)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]phenyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11168308 |
| Molecular Formula | C24H28ClN5O4S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (2R)-1-N-(4-chlorophenyl)-2-N-[4-[(E)-N-methylsulfonyl-C-pyrrolidin-1-ylcarbonimidoyl]phenyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | CS(=O)(=O)/N=C(\c1ccc(NC(=O)[C@H]2CCCN2C(=O)Nc2ccc(Cl)cc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C24H28ClN5O4S/c1-35(33,34)28-22(29-14-2-3-15-29)17-6-10-19(11-7-17)26-23(31)21-5-4-16-30(21)24(32)27-20-12-8-18(25)9-13-20/h6-13,21H,2-5,14-16H2,1H3,(H,26,31)(H,27,32)/b28-22+/t21-/m1/s1 |
| InChIKey | ZSEUCALPGWIIIH-PISCTYJTSA-N |
| XLogP | 3.78 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|