C22H36Cl2N10O — CID 11168496
3,5-diamino-6-chloro-N-[N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride (PubChem CID 11168496) has the molecular formula C22H36Cl2N10O and a molecular weight of 527.51 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11168496 |
| Molecular Formula | C22H36Cl2N10O |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[1-[4-(1H-imidazol-2-yl)butyl]piperidin-4-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride |
| SMILES | Cl.N/C(=N\CCCCC1CCN(CCCCc2ncc[nH]2)CC1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C22H35ClN10O.ClH/c23-18-20(25)31-19(24)17(30-18)21(34)32-22(26)29-9-3-1-5-15-7-13-33(14-8-15)12-4-2-6-16-27-10-11-28-16;/h10-11,15H,1-9,12-14H2,(H,27,28)(H4,24,25,31)(H3,26,29,32,34);1H |
| InChIKey | ZJDXTQHJRAQPSL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 177.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|