C12H18O5 — CID 11168516
(3R,4S,5S)-3,4-bis(methoxymethoxy)-5-prop-2-ynoxycyclopentene (PubChem CID 11168516) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-bis(methoxymethoxy)-5-prop-2-ynoxycyclopentene.
| Compound Name | (3R,4S,5S)-3,4-bis(methoxymethoxy)-5-prop-2-ynoxycyclopentene |
|---|---|
| PubChem CID | 11168516 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3R,4S,5S)-3,4-bis(methoxymethoxy)-5-prop-2-ynoxycyclopentene |
| SMILES | C#CCO[C@H]1C=C[C@@H](OCOC)[C@H]1OCOC |
| InChI | InChI=1S/C12H18O5/c1-4-7-15-10-5-6-11(16-8-13-2)12(10)17-9-14-3/h1,5-6,10-12H,7-9H2,2-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | XZZFDYAIRIRCEK-TUAOUCFPSA-N |
| XLogP | 0.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|