C24H37IN6O — CID 111685507
1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine;hydroiodide (PubChem CID 111685507) has the molecular formula C24H37IN6O and a molecular weight of 552.51 g/mol. Its IUPAC name is 1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111685507 |
| Molecular Formula | C24H37IN6O |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN1CCN(c2cc(CN/C(=N/C)NCC(C)Oc3cccc(C)c3)ccn2)CC1.I |
| InChI | InChI=1S/C24H36N6O.HI/c1-5-29-11-13-30(14-12-29)23-16-21(9-10-26-23)18-28-24(25-4)27-17-20(3)31-22-8-6-7-19(2)15-22;/h6-10,15-16,20H,5,11-14,17-18H2,1-4H3,(H2,25,27,28);1H |
| InChIKey | JZAPEFTXHZLHAB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|