About diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate
diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 11168564) has the molecular formula C30H30NO6P
and a molecular weight of 531.55 g/mol. Its IUPAC name is diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
Molecular Properties
| Compound Name | diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| PubChem CID | 11168564 |
| Molecular Formula | C30H30NO6P |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CCOC(=O)C(C(C(=O)OCC)N1C(=O)CCC1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30NO6P/c1-3-36-29(34)27(31-25(32)20-21-26(31)33)28(30(35)37-4-2)38(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,27H,3-4,20-21H2,1-2H3 |
| InChIKey | QPTNJEDOWCBOGM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
The IUPAC name of diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (CID 11168564) is diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
What is the SMILES notation for diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
The canonical SMILES for diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate is CCOC(=O)C(C(C(=O)OCC)N1C(=O)CCC1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
The InChIKey is QPTNJEDOWCBOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30NO6P/c1-3-36-29(34)27(31-25(32)20-21-26(31)33)28(30(35)37-4-2)38(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,27H,3-4,20-21H2,1-2H3.
What are the key properties of diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate has a molecular weight of 531.55 g/mol, XLogP of 2.80, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate is sourced from PubChem (CID 11168564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).