C30H56O4Si2 — CID 11168640
(1R,2S,3S,5S,6R,8R,10R,11S,13R)-3-[tert-butyl(dimethyl)silyl]oxy-1,8,11-trimethyl-6-triethylsilyloxy-14-oxatetracyclo[11.2.1.02,11.05,10]hexadecan-15-one (PubChem CID 11168640) has the molecular formula C30H56O4Si2 and a molecular weight of 536.95 g/mol. Its IUPAC name is (1R,2S,3S,5S,6R,8R,10R,11S,13R)-3-[tert-butyl(dimethyl)silyl]oxy-1,8,11-trimethyl-6-triethylsilyloxy-14-oxatetracyclo[11.2.1.02,11.05,10]hexadecan-15-one.
| Compound Name | (1R,2S,3S,5S,6R,8R,10R,11S,13R)-3-[tert-butyl(dimethyl)silyl]oxy-1,8,11-trimethyl-6-triethylsilyloxy-14-oxatetracyclo[11.2.1.02,11.05,10]hexadecan-15-one |
|---|---|
| PubChem CID | 11168640 |
| Molecular Formula | C30H56O4Si2 |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | (1R,2S,3S,5S,6R,8R,10R,11S,13R)-3-[tert-butyl(dimethyl)silyl]oxy-1,8,11-trimethyl-6-triethylsilyloxy-14-oxatetracyclo[11.2.1.02,11.05,10]hexadecan-15-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@H](C)C[C@@H]2[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@@]2(C)C[C@@H]2C[C@@]1(C)C(=O)O2 |
| InChI | InChI=1S/C30H56O4Si2/c1-12-36(13-2,14-3)34-24-16-20(4)15-23-22(24)17-25(33-35(10,11)28(5,6)7)26-29(23,8)18-21-19-30(26,9)27(31)32-21/h20-26H,12-19H2,1-11H3/t20-,21-,22+,23-,24-,25+,26+,29+,30-/m1/s1 |
| InChIKey | PMTDITXUCKMLKP-GWDCYGTCSA-N |
| XLogP | 8.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|