C19H33IN4O3 — CID 111687133
tert-butyl N-[2-[[N'-methyl-N-[2-(2-methylphenoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111687133) has the molecular formula C19H33IN4O3 and a molecular weight of 492.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[2-(2-methylphenoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[2-(2-methylphenoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111687133 |
| Molecular Formula | C19H33IN4O3 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[2-(2-methylphenoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCC(C)Oc1ccccc1C.I |
| InChI | InChI=1S/C19H32N4O3.HI/c1-14-9-7-8-10-16(14)25-15(2)13-23-17(20-6)21-11-12-22-18(24)26-19(3,4)5;/h7-10,15H,11-13H2,1-6H3,(H,22,24)(H2,20,21,23);1H |
| InChIKey | RQXUQLLXGZABKT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|