C34H49NO3Si — CID 11168794
(7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,8,12-tetramethyl-4-oxotrideca-7,11-dienamide (PubChem CID 11168794) has the molecular formula C34H49NO3Si and a molecular weight of 547.86 g/mol. Its IUPAC name is (7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,8,12-tetramethyl-4-oxotrideca-7,11-dienamide.
| Compound Name | (7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,8,12-tetramethyl-4-oxotrideca-7,11-dienamide |
|---|---|
| PubChem CID | 11168794 |
| Molecular Formula | C34H49NO3Si |
| Molecular Weight | 547.86 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | (7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,8,12-tetramethyl-4-oxotrideca-7,11-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/CCC(=O)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)N(C)C |
| InChI | InChI=1S/C34H49NO3Si/c1-27(2)17-15-18-28(3)19-16-24-32(36)29(25-33(37)35(7)8)26-38-39(34(4,5)6,30-20-11-9-12-21-30)31-22-13-10-14-23-31/h9-14,17,19-23,29H,15-16,18,24-26H2,1-8H3/b28-19+ |
| InChIKey | ASDVVTSCWYBDOC-TURZUDJPSA-N |
| XLogP | 6.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.86 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|