C16H21F3IN9S — CID 111688259
2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688259) has the molecular formula C16H21F3IN9S and a molecular weight of 555.37 g/mol. Its IUPAC name is 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688259 |
| Molecular Formula | C16H21F3IN9S |
| Molecular Weight | 555.37 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C16H20F3N9S.HI/c1-20-15(22-4-3-12-27-11(8-29-12)16(17,18)19)23-6-5-21-13-10-7-26-28(2)14(10)25-9-24-13;/h7-9H,3-6H2,1-2H3,(H2,20,22,23)(H,21,24,25);1H |
| InChIKey | GBJOXFSJHRALSL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|