C17H24F3N5S2 — CID 111689450
1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689450) has the molecular formula C17H24F3N5S2 and a molecular weight of 419.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689450 |
| Molecular Formula | C17H24F3N5S2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCc1nc(CC)c(C)s1 |
| InChI | InChI=1S/C17H24F3N5S2/c1-4-12-11(3)27-15(24-12)7-9-23-16(21-5-2)22-8-6-14-25-13(10-26-14)17(18,19)20/h10H,4-9H2,1-3H3,(H2,21,22,23) |
| InChIKey | LDHQZCCWNUYMLC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|