C16H22F3N5S2 — CID 111689614
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689614) has the molecular formula C16H22F3N5S2 and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689614 |
| Molecular Formula | C16H22F3N5S2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCc1nc(CCN/C(=N/C)NCCc2nc(C(F)(F)F)cs2)sc1C |
| InChI | InChI=1S/C16H22F3N5S2/c1-4-11-10(2)26-14(23-11)6-8-22-15(20-3)21-7-5-13-24-12(9-25-13)16(17,18)19/h9H,4-8H2,1-3H3,(H2,20,21,22) |
| InChIKey | NZDPBLDZKCKQNQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|