C16H29F3N4OS — CID 111690084
1-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111690084) has the molecular formula C16H29F3N4OS and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111690084 |
| Molecular Formula | C16H29F3N4OS |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H29F3N4OS/c1-3-20-14(21-11-15(25-2)5-8-24-9-6-15)22-13-4-7-23(10-13)12-16(17,18)19/h13H,3-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | PLWBEDFDUZOKCT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|