C15H28F3IN4OS — CID 111690131
2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111690131) has the molecular formula C15H28F3IN4OS and a molecular weight of 496.38 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111690131 |
| Molecular Formula | C15H28F3IN4OS |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C15H27F3N4OS.HI/c1-19-13(20-10-14(24-2)4-7-23-8-5-14)21-12-3-6-22(9-12)11-15(16,17)18;/h12H,3-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | YBZUBQHJNGBHJC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|