C22H36N4O2 — CID 111690332
N-cyclohexyl-3-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]propanamide (PubChem CID 111690332) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is N-cyclohexyl-3-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111690332 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | N-cyclohexyl-3-[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCCCC1)NCc1ccccc1OC(C)(C)C |
| InChI | InChI=1S/C22H36N4O2/c1-22(2,3)28-19-13-9-8-10-17(19)16-25-21(23-4)24-15-14-20(27)26-18-11-6-5-7-12-18/h8-10,13,18H,5-7,11-12,14-16H2,1-4H3,(H,26,27)(H2,23,24,25) |
| InChIKey | QBVBWXMHHPKNLU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|