C22H39N5O — CID 111691238
3-[[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide (PubChem CID 111691238) has the molecular formula C22H39N5O and a molecular weight of 389.59 g/mol. Its IUPAC name is 3-[[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide.
| Compound Name | 3-[[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 111691238 |
| Molecular Formula | C22H39N5O |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.32 |
| IUPAC Name | 3-[[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(CN/C(=N/C)NCCCN(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C22H39N5O/c1-7-12-24-21(28)20-11-8-10-19(15-20)16-26-22(23-6)25-13-9-14-27(17(2)3)18(4)5/h8,10-11,15,17-18H,7,9,12-14,16H2,1-6H3,(H,24,28)(H2,23,25,26) |
| InChIKey | LIBWUFOCTFNJSV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|