C21H37N5O — CID 111691470
2-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide (PubChem CID 111691470) has the molecular formula C21H37N5O and a molecular weight of 375.56 g/mol. Its IUPAC name is 2-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 111691470 |
| Molecular Formula | C21H37N5O |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 2-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H37N5O/c1-17(2)26(18(3)4)15-9-13-24-21(22-5)25-16-20(27)23-14-12-19-10-7-6-8-11-19/h6-8,10-11,17-18H,9,12-16H2,1-5H3,(H,23,27)(H2,22,24,25) |
| InChIKey | YAPFCCQETNRCKZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|