C40H42N2Si — CID 11169162
2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl-trimethylsilane (PubChem CID 11169162) has the molecular formula C40H42N2Si and a molecular weight of 578.88 g/mol. Its IUPAC name is 2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11169162 |
| Molecular Formula | C40H42N2Si |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C#C[Si](C)(C)C)cc(C)c1C(=[N+]=[N-])c1c2ccccc2c(-c2c(C)cc(C(C)(C)C)cc2C)c2ccccc12 |
| InChI | InChI=1S/C40H42N2Si/c1-25-21-29(19-20-43(8,9)10)22-26(2)36(25)39(42-41)38-33-17-13-11-15-31(33)37(32-16-12-14-18-34(32)38)35-27(3)23-30(24-28(35)4)40(5,6)7/h11-18,21-24H,1-10H3 |
| InChIKey | YQOOTDKBORSTTK-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|