C20H38IN5O2S — CID 111691727
1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide (PubChem CID 111691727) has the molecular formula C20H38IN5O2S and a molecular weight of 539.53 g/mol. Its IUPAC name is 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111691727 |
| Molecular Formula | C20H38IN5O2S |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCc1ccc(S(=O)(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C20H37N5O2S.HI/c1-16(2)25(17(3)4)14-8-13-22-20(21-5)23-15-18-9-11-19(12-10-18)28(26,27)24(6)7;/h9-12,16-17H,8,13-15H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | QUDQDKCHHGCTNF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|