C15H30N6O — CID 111692130
1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine (PubChem CID 111692130) has the molecular formula C15H30N6O and a molecular weight of 310.45 g/mol. Its IUPAC name is 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine.
| Compound Name | 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111692130 |
| Molecular Formula | C15H30N6O |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCc1nc(C)no1 |
| InChI | InChI=1S/C15H30N6O/c1-11(2)21(12(3)4)9-7-8-17-15(16-6)18-10-14-19-13(5)20-22-14/h11-12H,7-10H2,1-6H3,(H2,16,17,18) |
| InChIKey | BSEFJSYEEWZMMI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|