C20H44IN5 — CID 111692587
1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111692587) has the molecular formula C20H44IN5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111692587 |
| Molecular Formula | C20H44IN5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCC1CCCN(C(C)C)C1.I |
| InChI | InChI=1S/C20H43N5.HI/c1-16(2)24-12-8-10-19(15-24)14-23-20(21-7)22-11-9-13-25(17(3)4)18(5)6;/h16-19H,8-15H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | OEXFUIPWNNZEIC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|