C19H37IN6 — CID 111692601
1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide (PubChem CID 111692601) has the molecular formula C19H37IN6 and a molecular weight of 476.45 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111692601 |
| Molecular Formula | C19H37IN6 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCc1ccnc(N(C)C)c1.I |
| InChI | InChI=1S/C19H36N6.HI/c1-15(2)25(16(3)4)12-8-10-22-19(20-5)23-14-17-9-11-21-18(13-17)24(6)7;/h9,11,13,15-16H,8,10,12,14H2,1-7H3,(H2,20,22,23);1H |
| InChIKey | FZCKTXPLLDFYCX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|