C25H45N5O2 — CID 111693244
1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111693244) has the molecular formula C25H45N5O2 and a molecular weight of 447.67 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111693244 |
| Molecular Formula | C25H45N5O2 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.36 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCCCOCCOCCN/C(=N/Cc1ccc(CN2CCN(CC)CC2)cc1)NCC |
| InChI | InChI=1S/C25H45N5O2/c1-4-7-17-31-19-20-32-18-12-27-25(26-5-2)28-21-23-8-10-24(11-9-23)22-30-15-13-29(6-3)14-16-30/h8-11H,4-7,12-22H2,1-3H3,(H2,26,27,28) |
| InChIKey | VUBYPHKUCQSBMS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|