C18H28BrN5O2 — CID 111693780
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-butoxyethoxy)ethyl]-2-methylguanidine (PubChem CID 111693780) has the molecular formula C18H28BrN5O2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-butoxyethoxy)ethyl]-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-butoxyethoxy)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111693780 |
| Molecular Formula | C18H28BrN5O2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-butoxyethoxy)ethyl]-2-methylguanidine |
| SMILES | CCCCOCCOCCN/C(=N\C)NCc1cn2cc(Br)ccc2n1 |
| InChI | InChI=1S/C18H28BrN5O2/c1-3-4-8-25-10-11-26-9-7-21-18(20-2)22-12-16-14-24-13-15(19)5-6-17(24)23-16/h5-6,13-14H,3-4,7-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | DHUWNLGCXXKZFP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|