C18H25IN6O — CID 111694819
1-(1-benzofuran-2-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111694819) has the molecular formula C18H25IN6O and a molecular weight of 468.34 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111694819 |
| Molecular Formula | C18H25IN6O |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)N(C)Cc1cc2ccccc2o1.I |
| InChI | InChI=1S/C18H24N6O.HI/c1-5-19-18(20-11-17-22-21-13(2)24(17)4)23(3)12-15-10-14-8-6-7-9-16(14)25-15;/h6-10H,5,11-12H2,1-4H3,(H,19,20);1H |
| InChIKey | XOGORDHTYWWIFU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|