C27H30F2N7O6P — CID 11169490
[(2S)-1-[3-[4-[[1-[2-(2,3-difluoroanilino)-2-oxoethyl]pyrazol-4-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 11169490) has the molecular formula C27H30F2N7O6P and a molecular weight of 617.55 g/mol. Its IUPAC name is [(2S)-1-[3-[4-[[1-[2-(2,3-difluoroanilino)-2-oxoethyl]pyrazol-4-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S)-1-[3-[4-[[1-[2-(2,3-difluoroanilino)-2-oxoethyl]pyrazol-4-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11169490 |
| Molecular Formula | C27H30F2N7O6P |
| Molecular Weight | 617.55 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | [(2S)-1-[3-[4-[[1-[2-(2,3-difluoroanilino)-2-oxoethyl]pyrazol-4-yl]amino]quinazolin-7-yl]oxypropyl]pyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C(Cn1cc(Nc2ncnc3cc(OCCCN4CCC[C@H]4COP(=O)(O)O)ccc23)cn1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C27H30F2N7O6P/c28-22-5-1-6-23(26(22)29)34-25(37)15-36-14-18(13-32-36)33-27-21-8-7-20(12-24(21)30-17-31-27)41-11-3-10-35-9-2-4-19(35)16-42-43(38,39)40/h1,5-8,12-14,17,19H,2-4,9-11,15-16H2,(H,34,37)(H,30,31,33)(H2,38,39,40)/t19-/m0/s1 |
| InChIKey | CTQMRUXMUVMMNE-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|